About 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine
3-methoxy-2-methyl-1,2-dihydropyridin-6-amine (PubChem CID 86340861) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine |
| PubChem CID | 86340861 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine |
| SMILES | COC1=CC=C(N)NC1C |
| InChI | InChI=1S/C7H12N2O/c1-5-6(10-2)3-4-7(8)9-5/h3-5,9H,8H2,1-2H3 |
| InChIKey | NAIHHNKFNFAULL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine?
The IUPAC name of 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine (CID 86340861) is 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine.
What is the SMILES notation for 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine?
The canonical SMILES for 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine is COC1=CC=C(N)NC1C.
What is the InChIKey of 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine?
The InChIKey is NAIHHNKFNFAULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-6(10-2)3-4-7(8)9-5/h3-5,9H,8H2,1-2H3.
What are the key properties of 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine?
3-methoxy-2-methyl-1,2-dihydropyridin-6-amine has a molecular weight of 140.19 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-methyl-1,2-dihydropyridin-6-amine is sourced from PubChem (CID 86340861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).