About (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol
(6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol (PubChem CID 86341004) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol.
Molecular Properties
| Compound Name | (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol |
| PubChem CID | 86341004 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol |
| SMILES | CC1=C(CO)CNC(N)=C1 |
| InChI | InChI=1S/C7H12N2O/c1-5-2-7(8)9-3-6(5)4-10/h2,9-10H,3-4,8H2,1H3 |
| InChIKey | IEBJTIDZLZVOHY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol?
The IUPAC name of (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol (CID 86341004) is (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol.
What is the SMILES notation for (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol?
The canonical SMILES for (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol is CC1=C(CO)CNC(N)=C1.
What is the InChIKey of (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol?
The InChIKey is IEBJTIDZLZVOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-2-7(8)9-3-6(5)4-10/h2,9-10H,3-4,8H2,1H3.
What are the key properties of (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol?
(6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol has a molecular weight of 140.19 g/mol, XLogP of -0.30, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol is sourced from PubChem (CID 86341004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).