About 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide
2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide (PubChem CID 86341354) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide |
| PubChem CID | 86341354 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide |
| SMILES | CNC1Nc2ccccc2N1CC(N)=O |
| InChI | InChI=1S/C10H14N4O/c1-12-10-13-7-4-2-3-5-8(7)14(10)6-9(11)15/h2-5,10,12-13H,6H2,1H3,(H2,11,15) |
| InChIKey | DFFYJOUDNPXAJZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide?
The IUPAC name of 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide (CID 86341354) is 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide.
What is the SMILES notation for 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide?
The canonical SMILES for 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide is CNC1Nc2ccccc2N1CC(N)=O.
What is the InChIKey of 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide?
The InChIKey is DFFYJOUDNPXAJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-12-10-13-7-4-2-3-5-8(7)14(10)6-9(11)15/h2-5,10,12-13H,6H2,1H3,(H2,11,15).
What are the key properties of 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide?
2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide has a molecular weight of 206.25 g/mol, XLogP of -0.09, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methylamino)-2,3-dihydrobenzimidazol-1-yl]acetamide is sourced from PubChem (CID 86341354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).