About 6-iodo-2-methyl-1,2-dihydropyridin-3-ol
6-iodo-2-methyl-1,2-dihydropyridin-3-ol (PubChem CID 86341503) has the molecular formula C6H8INO
and a molecular weight of 237.04 g/mol. Its IUPAC name is 6-iodo-2-methyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 6-iodo-2-methyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 86341503 |
| Molecular Formula | C6H8INO |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 6-iodo-2-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1NC(I)=CC=C1O |
| InChI | InChI=1S/C6H8INO/c1-4-5(9)2-3-6(7)8-4/h2-4,8-9H,1H3 |
| InChIKey | DUWDHLVUBJAWFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2-methyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2-methyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 6-iodo-2-methyl-1,2-dihydropyridin-3-ol (CID 86341503) is 6-iodo-2-methyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 6-iodo-2-methyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 6-iodo-2-methyl-1,2-dihydropyridin-3-ol is CC1NC(I)=CC=C1O.
What is the InChIKey of 6-iodo-2-methyl-1,2-dihydropyridin-3-ol?
The InChIKey is DUWDHLVUBJAWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8INO/c1-4-5(9)2-3-6(7)8-4/h2-4,8-9H,1H3.
What are the key properties of 6-iodo-2-methyl-1,2-dihydropyridin-3-ol?
6-iodo-2-methyl-1,2-dihydropyridin-3-ol has a molecular weight of 237.04 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2-methyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 86341503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).