About 4-bromo-2-methyl-1,2-dihydropyridin-3-ol
4-bromo-2-methyl-1,2-dihydropyridin-3-ol (PubChem CID 86341526) has the molecular formula C6H8BrNO
and a molecular weight of 190.04 g/mol. Its IUPAC name is 4-bromo-2-methyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 4-bromo-2-methyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 86341526 |
| Molecular Formula | C6H8BrNO |
| Molecular Weight | 190.04 g/mol |
| Exact Mass | 188.98 |
| IUPAC Name | 4-bromo-2-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1NC=CC(Br)=C1O |
| InChI | InChI=1S/C6H8BrNO/c1-4-6(9)5(7)2-3-8-4/h2-4,8-9H,1H3 |
| InChIKey | XSWPICHPJWJLJP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-methyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 4-bromo-2-methyl-1,2-dihydropyridin-3-ol (CID 86341526) is 4-bromo-2-methyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 4-bromo-2-methyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 4-bromo-2-methyl-1,2-dihydropyridin-3-ol is CC1NC=CC(Br)=C1O.
What is the InChIKey of 4-bromo-2-methyl-1,2-dihydropyridin-3-ol?
The InChIKey is XSWPICHPJWJLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrNO/c1-4-6(9)5(7)2-3-8-4/h2-4,8-9H,1H3.
What are the key properties of 4-bromo-2-methyl-1,2-dihydropyridin-3-ol?
4-bromo-2-methyl-1,2-dihydropyridin-3-ol has a molecular weight of 190.04 g/mol, XLogP of 1.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 86341526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).