About 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid
5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid (PubChem CID 86341619) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid |
| PubChem CID | 86341619 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid |
| SMILES | O=C(O)n1ccc2c1=CNCC=2 |
| InChI | InChI=1S/C8H8N2O2/c11-8(12)10-4-2-6-1-3-9-5-7(6)10/h1-2,4-5,9H,3H2,(H,11,12) |
| InChIKey | RXWDXLIJETUIQE-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid?
The IUPAC name of 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid (CID 86341619) is 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid.
What is the SMILES notation for 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid?
The canonical SMILES for 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid is O=C(O)n1ccc2c1=CNCC=2.
What is the InChIKey of 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid?
The InChIKey is RXWDXLIJETUIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-8(12)10-4-2-6-1-3-9-5-7(6)10/h1-2,4-5,9H,3H2,(H,11,12).
What are the key properties of 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid?
5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid has a molecular weight of 164.16 g/mol, XLogP of -0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydropyrrolo[2,3-c]pyridine-1-carboxylic acid is sourced from PubChem (CID 86341619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).