About 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol
6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol (PubChem CID 86341682) has the molecular formula C7H10BrNO
and a molecular weight of 204.07 g/mol. Its IUPAC name is 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 86341682 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1=C(O)C(C)NC(Br)=C1 |
| InChI | InChI=1S/C7H10BrNO/c1-4-3-6(8)9-5(2)7(4)10/h3,5,9-10H,1-2H3 |
| InChIKey | AMWSIUMWSJKEIE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol (CID 86341682) is 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol is CC1=C(O)C(C)NC(Br)=C1.
What is the InChIKey of 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol?
The InChIKey is AMWSIUMWSJKEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrNO/c1-4-3-6(8)9-5(2)7(4)10/h3,5,9-10H,1-2H3.
What are the key properties of 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol?
6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol has a molecular weight of 204.07 g/mol, XLogP of 2.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4-dimethyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 86341682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).