About 5-amino-4-methyl-1,2-dihydropyridin-3-ol
5-amino-4-methyl-1,2-dihydropyridin-3-ol (PubChem CID 86341729) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-amino-4-methyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 5-amino-4-methyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 86341729 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-amino-4-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1=C(O)CNC=C1N |
| InChI | InChI=1S/C6H10N2O/c1-4-5(7)2-8-3-6(4)9/h2,8-9H,3,7H2,1H3 |
| InChIKey | RNCMAADDVQHGKU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-4-methyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 5-amino-4-methyl-1,2-dihydropyridin-3-ol (CID 86341729) is 5-amino-4-methyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 5-amino-4-methyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 5-amino-4-methyl-1,2-dihydropyridin-3-ol is CC1=C(O)CNC=C1N.
What is the InChIKey of 5-amino-4-methyl-1,2-dihydropyridin-3-ol?
The InChIKey is RNCMAADDVQHGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4-5(7)2-8-3-6(4)9/h2,8-9H,3,7H2,1H3.
What are the key properties of 5-amino-4-methyl-1,2-dihydropyridin-3-ol?
5-amino-4-methyl-1,2-dihydropyridin-3-ol has a molecular weight of 126.16 g/mol, XLogP of 0.22, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 86341729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).