About 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine
2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 86341844) has the molecular formula C19H16N2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 86341844 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | C1=Cc2c([nH]c(-c3ccccc3)c2-c2ccccc2)CN1 |
| InChI | InChI=1S/C19H16N2/c1-3-7-14(8-4-1)18-16-11-12-20-13-17(16)21-19(18)15-9-5-2-6-10-15/h1-12,20-21H,13H2 |
| InChIKey | SAFIVOLQNJMSLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine (CID 86341844) is 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine is C1=Cc2c([nH]c(-c3ccccc3)c2-c2ccccc2)CN1.
What is the InChIKey of 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is SAFIVOLQNJMSLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2/c1-3-7-14(8-4-1)18-16-11-12-20-13-17(16)21-19(18)15-9-5-2-6-10-15/h1-12,20-21H,13H2.
What are the key properties of 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine?
2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 272.35 g/mol, XLogP of 4.42, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyl-6,7-dihydro-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 86341844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).