About N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine
N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine (PubChem CID 86341870) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine |
| PubChem CID | 86341870 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine |
| SMILES | CN(C1CCOCC1)C1C=CC=CN1 |
| InChI | InChI=1S/C11H18N2O/c1-13(10-5-8-14-9-6-10)11-4-2-3-7-12-11/h2-4,7,10-12H,5-6,8-9H2,1H3 |
| InChIKey | VFIKRKNOOAYIRG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The IUPAC name of N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine (CID 86341870) is N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine.
What is the SMILES notation for N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The canonical SMILES for N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine is CN(C1CCOCC1)C1C=CC=CN1.
What is the InChIKey of N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The InChIKey is VFIKRKNOOAYIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-13(10-5-8-14-9-6-10)11-4-2-3-7-12-11/h2-4,7,10-12H,5-6,8-9H2,1H3.
What are the key properties of N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine has a molecular weight of 194.28 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(oxan-4-yl)-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 86341870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).