C14H13BrF2N4O4 — CID 86342024
(6S)-N-[[2-bromo-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 86342024) has the molecular formula C14H13BrF2N4O4 and a molecular weight of 419.18 g/mol. Its IUPAC name is (6S)-N-[[2-bromo-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-N-[[2-bromo-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 86342024 |
| Molecular Formula | C14H13BrF2N4O4 |
| Molecular Weight | 419.18 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (6S)-N-[[2-bromo-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCc1ccc(OC(F)F)cc1Br)C2 |
| InChI | InChI=1S/C14H13BrF2N4O4/c15-11-3-10(25-13(16)17)2-1-8(11)4-18-9-5-20-6-12(21(22)23)19-14(20)24-7-9/h1-3,6,9,13,18H,4-5,7H2/t9-/m0/s1 |
| InChIKey | HNPWXRRXNAYHJX-VIFPVBQESA-N |
| XLogP | 2.71 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|