C17H15N3O2S — CID 86342555
17-hydroxy-3-methyl-7-thia-3,10,13-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(20),4(8),5,14(19),15,17-hexaen-9-one (PubChem CID 86342555) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 17-hydroxy-3-methyl-7-thia-3,10,13-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(20),4(8),5,14(19),15,17-hexaen-9-one.
| Compound Name | 17-hydroxy-3-methyl-7-thia-3,10,13-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(20),4(8),5,14(19),15,17-hexaen-9-one |
|---|---|
| PubChem CID | 86342555 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 17-hydroxy-3-methyl-7-thia-3,10,13-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(20),4(8),5,14(19),15,17-hexaen-9-one |
| SMILES | CN1c2ccsc2C(=O)N2CCn3c(cc4cc(O)ccc43)C21 |
| InChI | InChI=1S/C17H15N3O2S/c1-18-13-4-7-23-15(13)17(22)20-6-5-19-12-3-2-11(21)8-10(12)9-14(19)16(18)20/h2-4,7-9,16,21H,5-6H2,1H3 |
| InChIKey | QLPJNQHEDRXYLE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |