C23H19Cl2N3 — CID 86342557
(2S,10R)-7,19-dichloro-3,10,13-trimethyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),4(9),5,7,11,14,17(22),18,20-nonaene (PubChem CID 86342557) has the molecular formula C23H19Cl2N3 and a molecular weight of 408.33 g/mol. Its IUPAC name is (2S,10R)-7,19-dichloro-3,10,13-trimethyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),4(9),5,7,11,14,17(22),18,20-nonaene.
| Compound Name | (2S,10R)-7,19-dichloro-3,10,13-trimethyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),4(9),5,7,11,14,17(22),18,20-nonaene |
|---|---|
| PubChem CID | 86342557 |
| Molecular Formula | C23H19Cl2N3 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (2S,10R)-7,19-dichloro-3,10,13-trimethyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),4(9),5,7,11,14,17(22),18,20-nonaene |
| SMILES | CN1c2ccc(Cl)cc2[C@@]2(C)c3cn(C)cc3-c3c([nH]c4ccc(Cl)cc34)[C@@H]12 |
| InChI | InChI=1S/C23H19Cl2N3/c1-23-16-9-13(25)5-7-19(16)28(3)22(23)21-20(15-10-27(2)11-17(15)23)14-8-12(24)4-6-18(14)26-21/h4-11,22,26H,1-3H3/t22-,23+/m1/s1 |
| InChIKey | VOENECZXFQZIKA-PKTZIBPZSA-N |
| XLogP | 6.29 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|