C27H36N6O3S — CID 86342648
12-(4-morpholin-4-ylcyclohexyl)oxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine (PubChem CID 86342648) has the molecular formula C27H36N6O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is 12-(4-morpholin-4-ylcyclohexyl)oxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine.
| Compound Name | 12-(4-morpholin-4-ylcyclohexyl)oxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
|---|---|
| PubChem CID | 86342648 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 12-(4-morpholin-4-ylcyclohexyl)oxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
| SMILES | c1nn(C2CCOCC2)cc1Nc1nc(OC2CCC(N3CCOCC3)CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C27H36N6O3S/c1-2-22-23(3-1)37-26-24(22)25(36-21-6-4-19(5-7-21)32-10-14-35-15-11-32)30-27(31-26)29-18-16-28-33(17-18)20-8-12-34-13-9-20/h16-17,19-21H,1-15H2,(H,29,30,31) |
| InChIKey | VZFXVJPMSIOESI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |