C18H24ClF3O7S — CID 86343067
(2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-[2-(trifluoromethyl)phenyl]-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride (PubChem CID 86343067) has the molecular formula C18H24ClF3O7S and a molecular weight of 476.90 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-[2-(trifluoromethyl)phenyl]-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride.
| Compound Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-[2-(trifluoromethyl)phenyl]-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
|---|---|
| PubChem CID | 86343067 |
| Molecular Formula | C18H24ClF3O7S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-[2-(trifluoromethyl)phenyl]-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H]1OC(c2ccccc2C(F)(F)F)OC[C@H]1O.[Cl-] |
| InChI | InChI=1S/C18H24F3O7S.ClH/c19-18(20,21)10-4-2-1-3-9(10)17-27-6-11(23)16(28-17)13(25)8-29-7-12(24)15(26)14(29)5-22;/h1-4,11-17,22-26H,5-8H2;1H/q+1;/p-1/t11-,12-,13-,14-,15+,16+,17?,29?;/m1./s1 |
| InChIKey | GLSDNUJQELGGOA-HCFCZASXSA-M |
| XLogP | -3.44 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|