C19H19F2N3OS — CID 86343146
(4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(6-methyl-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 86343146) has the molecular formula C19H19F2N3OS and a molecular weight of 375.44 g/mol. Its IUPAC name is (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(6-methyl-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(6-methyl-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 86343146 |
| Molecular Formula | C19H19F2N3OS |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(6-methyl-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | Cc1ccc([C@H]2C[C@H]3CSC(N)=N[C@@]3(c3ccc(F)cc3F)CO2)cn1 |
| InChI | InChI=1S/C19H19F2N3OS/c1-11-2-3-12(8-23-11)17-6-13-9-26-18(22)24-19(13,10-25-17)15-5-4-14(20)7-16(15)21/h2-5,7-8,13,17H,6,9-10H2,1H3,(H2,22,24)/t13-,17+,19-/m0/s1 |
| InChIKey | BWTUQMLQTUOVBH-IRWQIABSSA-N |
| XLogP | 3.70 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |