C21H29N5O2S — CID 86343291
2-[(3R)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide (PubChem CID 86343291) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[(3R)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide.
| Compound Name | 2-[(3R)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide |
|---|---|
| PubChem CID | 86343291 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[(3R)-12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide |
| SMILES | NC(=O)C[C@H]1CCc2sc3ncnc(NC4CCC(N5CCOCC5)CC4)c3c21 |
| InChI | InChI=1S/C21H29N5O2S/c22-17(27)11-13-1-6-16-18(13)19-20(23-12-24-21(19)29-16)25-14-2-4-15(5-3-14)26-7-9-28-10-8-26/h12-15H,1-11H2,(H2,22,27)(H,23,24,25)/t13-,14?,15?/m1/s1 |
| InChIKey | PVWQZZSRECSKPI-WLYUNCDWSA-N |
| XLogP | 2.65 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |