C27H37N3O3 — CID 86343378
18-[ethyl(oxan-4-yl)amino]-8-methyl-3,7-diazatricyclo[15.4.0.05,10]henicosa-1(17),5(10),8,18,20-pentaene-2,6-dione (PubChem CID 86343378) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 18-[ethyl(oxan-4-yl)amino]-8-methyl-3,7-diazatricyclo[15.4.0.05,10]henicosa-1(17),5(10),8,18,20-pentaene-2,6-dione.
| Compound Name | 18-[ethyl(oxan-4-yl)amino]-8-methyl-3,7-diazatricyclo[15.4.0.05,10]henicosa-1(17),5(10),8,18,20-pentaene-2,6-dione |
|---|---|
| PubChem CID | 86343378 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 18-[ethyl(oxan-4-yl)amino]-8-methyl-3,7-diazatricyclo[15.4.0.05,10]henicosa-1(17),5(10),8,18,20-pentaene-2,6-dione |
| SMILES | CCN(c1cccc2c1CCCCCCc1cc(C)[nH]c(=O)c1CNC2=O)C1CCOCC1 |
| InChI | InChI=1S/C27H37N3O3/c1-3-30(21-13-15-33-16-14-21)25-12-8-11-23-22(25)10-7-5-4-6-9-20-17-19(2)29-27(32)24(20)18-28-26(23)31/h8,11-12,17,21H,3-7,9-10,13-16,18H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | LGPNZHVZDHOBFZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |