C18H16F3N3OS — CID 86343524
(4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(5-fluoro-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 86343524) has the molecular formula C18H16F3N3OS and a molecular weight of 379.41 g/mol. Its IUPAC name is (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(5-fluoro-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(5-fluoro-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 86343524 |
| Molecular Formula | C18H16F3N3OS |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-(5-fluoro-3-pyridinyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccc(F)cc3F)CO[C@@H](c3cncc(F)c3)C[C@H]2CS1 |
| InChI | InChI=1S/C18H16F3N3OS/c19-12-1-2-14(15(21)5-12)18-9-25-16(10-3-13(20)7-23-6-10)4-11(18)8-26-17(22)24-18/h1-3,5-7,11,16H,4,8-9H2,(H2,22,24)/t11-,16+,18-/m0/s1 |
| InChIKey | WWPKMTNUNPCENN-LSKLOWJMSA-N |
| XLogP | 3.53 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |