C19H17F2N5OS — CID 86343525
(4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-imidazo[1,2-a]pyrimidin-2-yl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 86343525) has the molecular formula C19H17F2N5OS and a molecular weight of 401.44 g/mol. Its IUPAC name is (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-imidazo[1,2-a]pyrimidin-2-yl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-imidazo[1,2-a]pyrimidin-2-yl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 86343525 |
| Molecular Formula | C19H17F2N5OS |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-imidazo[1,2-a]pyrimidin-2-yl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccc(F)cc3F)CO[C@@H](c3cn4cccnc4n3)C[C@H]2CS1 |
| InChI | InChI=1S/C19H17F2N5OS/c20-12-2-3-13(14(21)7-12)19-10-27-16(6-11(19)9-28-17(22)25-19)15-8-26-5-1-4-23-18(26)24-15/h1-5,7-8,11,16H,6,9-10H2,(H2,22,25)/t11-,16+,19-/m0/s1 |
| InChIKey | JCIKHUXHSBSJFB-MAAWUACBSA-N |
| XLogP | 3.04 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |