C16H23FNO7S+ — CID 86343644
(2R,3S,4S)-1-[(2S)-2-[(4S,5R)-2-(2-fluoro-4-pyridinyl)-5-hydroxy-1,3-dioxan-4-yl]-2-hydroxyethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol (PubChem CID 86343644) has the molecular formula C16H23FNO7S+ and a molecular weight of 392.43 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S)-2-[(4S,5R)-2-(2-fluoro-4-pyridinyl)-5-hydroxy-1,3-dioxan-4-yl]-2-hydroxyethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol.
| Compound Name | (2R,3S,4S)-1-[(2S)-2-[(4S,5R)-2-(2-fluoro-4-pyridinyl)-5-hydroxy-1,3-dioxan-4-yl]-2-hydroxyethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol |
|---|---|
| PubChem CID | 86343644 |
| Molecular Formula | C16H23FNO7S+ |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2R,3S,4S)-1-[(2S)-2-[(4S,5R)-2-(2-fluoro-4-pyridinyl)-5-hydroxy-1,3-dioxan-4-yl]-2-hydroxyethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H]1OC(c2ccnc(F)c2)OC[C@H]1O |
| InChI | InChI=1S/C16H23FNO7S/c17-13-3-8(1-2-18-13)16-24-5-9(20)15(25-16)11(22)7-26-6-10(21)14(23)12(26)4-19/h1-3,9-12,14-16,19-23H,4-7H2/q+1/t9-,10-,11-,12-,14+,15+,16?,26?/m1/s1 |
| InChIKey | NSODQKMJNWGZCF-PWFBUBENSA-N |
| XLogP | -1.93 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|