C31H25F4N5O4S — CID 86343713
(2R)-N-[4-[2-[[1,1-dioxo-6-(2,2,2-trifluoroethoxy)-2,3-dihydro-1-benzothiophen-5-yl]amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-(4-fluorophenyl)propanamide (PubChem CID 86343713) has the molecular formula C31H25F4N5O4S and a molecular weight of 639.63 g/mol. Its IUPAC name is (2R)-N-[4-[2-[[1,1-dioxo-6-(2,2,2-trifluoroethoxy)-2,3-dihydro-1-benzothiophen-5-yl]amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-(4-fluorophenyl)propanamide.
| Compound Name | (2R)-N-[4-[2-[[1,1-dioxo-6-(2,2,2-trifluoroethoxy)-2,3-dihydro-1-benzothiophen-5-yl]amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 86343713 |
| Molecular Formula | C31H25F4N5O4S |
| Molecular Weight | 639.63 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | (2R)-N-[4-[2-[[1,1-dioxo-6-(2,2,2-trifluoroethoxy)-2,3-dihydro-1-benzothiophen-5-yl]amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-(4-fluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(-c2ccc3nc(Nc4cc5c(cc4OCC(F)(F)F)S(=O)(=O)CC5)nn3c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H25F4N5O4S/c1-18(19-2-7-23(32)8-3-19)29(41)36-24-9-4-20(5-10-24)22-6-11-28-38-30(39-40(28)16-22)37-25-14-21-12-13-45(42,43)27(21)15-26(25)44-17-31(33,34)35/h2-11,14-16,18H,12-13,17H2,1H3,(H,36,41)(H,37,39)/t18-/m1/s1 |
| InChIKey | JQKSXVYRXBSNLB-GOSISDBHSA-N |
| XLogP | 6.29 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |