C23H19F3N4O5 — CID 86344319
N-[[3-[(3S)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 86344319) has the molecular formula C23H19F3N4O5 and a molecular weight of 488.42 g/mol. Its IUPAC name is N-[[3-[(3S)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[3-[(3S)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 86344319 |
| Molecular Formula | C23H19F3N4O5 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-[[3-[(3S)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cc1nc2ccc(CNC(=O)c3ccc(OC(F)(F)F)cc3)cc2c(=O)n1[C@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H19F3N4O5/c1-12-28-17-7-2-13(10-16(17)22(34)30(12)18-8-9-19(31)29-21(18)33)11-27-20(32)14-3-5-15(6-4-14)35-23(24,25)26/h2-7,10,18H,8-9,11H2,1H3,(H,27,32)(H,29,31,33)/t18-/m0/s1 |
| InChIKey | HWFZGHPLMTXECG-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|