C26H31F4N3O4 — CID 86344543
5-[(2R)-2-[2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(4-hydroxybutyl)indole-7-carboxamide (PubChem CID 86344543) has the molecular formula C26H31F4N3O4 and a molecular weight of 525.54 g/mol. Its IUPAC name is 5-[(2R)-2-[2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(4-hydroxybutyl)indole-7-carboxamide.
| Compound Name | 5-[(2R)-2-[2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(4-hydroxybutyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 86344543 |
| Molecular Formula | C26H31F4N3O4 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 5-[(2R)-2-[2-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(4-hydroxybutyl)indole-7-carboxamide |
| SMILES | C[C@H](Cc1cc(C(N)=O)c2c(ccn2CCCCO)c1)NCCOc1ccc(F)cc1OCC(F)(F)F |
| InChI | InChI=1S/C26H31F4N3O4/c1-17(32-7-11-36-22-5-4-20(27)15-23(22)37-16-26(28,29)30)12-18-13-19-6-9-33(8-2-3-10-34)24(19)21(14-18)25(31)35/h4-6,9,13-15,17,32,34H,2-3,7-8,10-12,16H2,1H3,(H2,31,35)/t17-/m1/s1 |
| InChIKey | PCRASRKMTUMYNN-QGZVFWFLSA-N |
| XLogP | 4.19 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|