C20H19N3OS — CID 86344974
21-methyl-7-methylsulfanyl-10,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2,4(9),5,7,15,17,19-heptaen-14-one (PubChem CID 86344974) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 21-methyl-7-methylsulfanyl-10,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2,4(9),5,7,15,17,19-heptaen-14-one.
| Compound Name | 21-methyl-7-methylsulfanyl-10,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2,4(9),5,7,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 86344974 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 21-methyl-7-methylsulfanyl-10,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2,4(9),5,7,15,17,19-heptaen-14-one |
| SMILES | CSc1ccc2cc3n(c2c1)CCN1C(=O)c2ccccc2N(C)C31 |
| InChI | InChI=1S/C20H19N3OS/c1-21-16-6-4-3-5-15(16)20(24)23-10-9-22-17-12-14(25-2)8-7-13(17)11-18(22)19(21)23/h3-8,11-12,19H,9-10H2,1-2H3 |
| InChIKey | KACRYOQYOYTOGH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |