C31H32F4N8O4 — CID 86345086
1-[(4-fluorophenyl)methyl]-3-[1-[2-[4-(morpholine-4-carbonyl)-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrrolidin-3-yl]urea (PubChem CID 86345086) has the molecular formula C31H32F4N8O4 and a molecular weight of 656.64 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[1-[2-[4-(morpholine-4-carbonyl)-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrrolidin-3-yl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[1-[2-[4-(morpholine-4-carbonyl)-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 86345086 |
| Molecular Formula | C31H32F4N8O4 |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 656.25 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[1-[2-[4-(morpholine-4-carbonyl)-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]pyrrolidin-3-yl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)NC1CCN(c2ccc3nc(Nc4ccc(C(=O)N5CCOCC5)cc4OCC(F)(F)F)nn3c2)C1 |
| InChI | InChI=1S/C31H32F4N8O4/c32-22-4-1-20(2-5-22)16-36-30(45)37-23-9-10-42(17-23)24-6-8-27-39-29(40-43(27)18-24)38-25-7-3-21(15-26(25)47-19-31(33,34)35)28(44)41-11-13-46-14-12-41/h1-8,15,18,23H,9-14,16-17,19H2,(H,38,40)(H2,36,37,45) |
| InChIKey | VYDZFOWEZRFPIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |