C17H15F3N2O — CID 86345157
[4-(3,4-difluorophenyl)piperazin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 86345157) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)piperazin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-(3,4-difluorophenyl)piperazin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 86345157 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [4-(3,4-difluorophenyl)piperazin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H15F3N2O/c18-13-3-1-2-12(10-13)17(23)22-8-6-21(7-9-22)14-4-5-15(19)16(20)11-14/h1-5,10-11H,6-9H2 |
| InChIKey | JKOXLRWWOUZDMG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |