C20H14O7 — CID 86345802
(3R,4S)-3,5,8,8'-tetrahydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-1-one (PubChem CID 86345802) has the molecular formula C20H14O7 and a molecular weight of 366.32 g/mol. Its IUPAC name is (3R,4S)-3,5,8,8'-tetrahydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-1-one.
| Compound Name | (3R,4S)-3,5,8,8'-tetrahydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-1-one |
|---|---|
| PubChem CID | 86345802 |
| Molecular Formula | C20H14O7 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (3R,4S)-3,5,8,8'-tetrahydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene]-1-one |
| SMILES | O=C1C[C@@H](O)[C@]2(Oc3cccc4c(O)ccc(c34)O2)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C20H14O7/c21-10-6-7-15-17-9(10)2-1-3-14(17)26-20(27-15)16(25)8-13(24)18-11(22)4-5-12(23)19(18)20/h1-7,16,21-23,25H,8H2/t16-,20-/m1/s1 |
| InChIKey | KGZLWNLQQVXESZ-OXQOHEQNSA-N |
| XLogP | 2.53 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|