C35H34F4N6O7S — CID 86345823
(2R)-2-(4-fluorophenyl)-N-[4-[2-[2-methoxy-N-[3-(methylamino)propanoyl]-4-methylsulfonylanilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 86345823) has the molecular formula C35H34F4N6O7S and a molecular weight of 758.75 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-N-[4-[2-[2-methoxy-N-[3-(methylamino)propanoyl]-4-methylsulfonylanilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-(4-fluorophenyl)-N-[4-[2-[2-methoxy-N-[3-(methylamino)propanoyl]-4-methylsulfonylanilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86345823 |
| Molecular Formula | C35H34F4N6O7S |
| Molecular Weight | 758.75 g/mol |
| Exact Mass | 758.21 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-N-[4-[2-[2-methoxy-N-[3-(methylamino)propanoyl]-4-methylsulfonylanilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CNCCC(=O)N(c1nc2ccc(-c3ccc(NC(=O)[C@H](C)c4ccc(F)cc4)cc3)cn2n1)c1ccc(S(C)(=O)=O)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H33FN6O5S.C2HF3O2/c1-21(22-5-10-25(34)11-6-22)32(42)36-26-12-7-23(8-13-26)24-9-16-30-37-33(38-39(30)20-24)40(31(41)17-18-35-2)28-15-14-27(46(4,43)44)19-29(28)45-3;3-2(4,5)1(6)7/h5-16,19-21,35H,17-18H2,1-4H3,(H,36,42);(H,6,7)/t21-;/m1./s1 |
| InChIKey | PWPZWFPRTYTWHP-ZMBIFBSDSA-N |
| XLogP | 5.60 |
| TPSA | 172.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |