C20H25N5O3S — CID 86345930
N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-yl-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine (PubChem CID 86345930) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-yl-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine.
| Compound Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-yl-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86345930 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-morpholin-4-yl-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CSCC3)c1 |
| InChI | InChI=1S/C20H25N5O3S/c1-26-15-3-4-18(27-2)14(11-15)12-21-24-20-22-17-5-10-29-13-16(17)19(23-20)25-6-8-28-9-7-25/h3-4,11-12H,5-10,13H2,1-2H3,(H,22,23,24)/b21-12+ |
| InChIKey | VDJNTMQRDIPLSB-CIAFOILYSA-N |
| XLogP | 2.57 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|