About 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile
2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile (PubChem CID 86346099) has the molecular formula C21H12Cl2N4O
and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile |
| PubChem CID | 86346099 |
| Molecular Formula | C21H12Cl2N4O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1cnnn1-c1ccccc1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H12Cl2N4O/c22-15-9-10-17(23)21(11-15)28-20-8-4-3-7-18(20)27-19(13-25-26-27)16-6-2-1-5-14(16)12-24/h1-11,13H |
| InChIKey | OVQJFLFTYCOXGU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile?
The IUPAC name of 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile (CID 86346099) is 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile.
What is the SMILES notation for 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile?
The canonical SMILES for 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile is N#Cc1ccccc1-c1cnnn1-c1ccccc1Oc1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile?
The InChIKey is OVQJFLFTYCOXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Cl2N4O/c22-15-9-10-17(23)21(11-15)28-20-8-4-3-7-18(20)27-19(13-25-26-27)16-6-2-1-5-14(16)12-24/h1-11,13H.
What are the key properties of 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile?
2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile has a molecular weight of 407.26 g/mol, XLogP of 5.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(2,5-dichlorophenoxy)phenyl]triazol-4-yl]benzonitrile is sourced from PubChem (CID 86346099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).