C20H2Cl4I4NaO5- — CID 86346652
sodium 4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate (PubChem CID 86346652) has the molecular formula C20H2Cl4I4NaO5- and a molecular weight of 994.65 g/mol. Its IUPAC name is sodium 4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate.
| Compound Name | sodium 4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
|---|---|
| PubChem CID | 86346652 |
| Molecular Formula | C20H2Cl4I4NaO5- |
| Molecular Weight | 994.65 g/mol |
| Exact Mass | 992.47 |
| IUPAC Name | sodium 4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| SMILES | O=C1OC2(c3cc(I)c([O-])c(I)c3Oc3c2cc(I)c([O-])c3I)c2c(Cl)c(Cl)c(Cl)c(Cl)c21.[Na+] |
| InChI | InChI=1S/C20H4Cl4I4O5.Na/c21-9-7-8(10(22)12(24)11(9)23)20(33-19(7)31)3-1-5(25)15(29)13(27)17(3)32-18-4(20)2-6(26)16(30)14(18)28;/h1-2,29-30H;/q;+1/p-2 |
| InChIKey | ZYEKMOLRPOIBPB-UHFFFAOYSA-L |
| XLogP | 4.44 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|