About 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 863763) has the molecular formula C11H17N5O2S
and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| PubChem CID | 863763 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C11H17N5O2S/c12-8-4-9(13)16-11(15-8)19-6-10(17)14-5-7-2-1-3-18-7/h4,7H,1-3,5-6H2,(H,14,17)(H4,12,13,15,16)/t7-/m0/s1 |
| InChIKey | ANSIKCDVTLBCLR-ZETCQYMHSA-N |
| XLogP | 0.03 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide (CID 863763) is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide is Nc1cc(N)nc(SCC(=O)NC[C@@H]2CCCO2)n1.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide?
The InChIKey is ANSIKCDVTLBCLR-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H17N5O2S/c12-8-4-9(13)16-11(15-8)19-6-10(17)14-5-7-2-1-3-18-7/h4,7H,1-3,5-6H2,(H,14,17)(H4,12,13,15,16)/t7-/m0/s1.
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide?
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide has a molecular weight of 283.36 g/mol, XLogP of 0.03, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]acetamide is sourced from PubChem (CID 863763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).