C16H16ClFN5O3+ — CID 8637702
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8637702) has the molecular formula C16H16ClFN5O3+ and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8637702 |
| Molecular Formula | C16H16ClFN5O3+ |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)amino]ethyl-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium |
| SMILES | Nc1nonc1C(=O)NCC[NH2+]Cc1ccc(-c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C16H15ClFN5O3/c17-11-7-9(1-3-12(11)18)13-4-2-10(25-13)8-20-5-6-21-16(24)14-15(19)23-26-22-14/h1-4,7,20H,5-6,8H2,(H2,19,23)(H,21,24)/p+1 |
| InChIKey | SLDIVJWEVLKUSK-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|