C17H22N4O2S — CID 863792
2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 863792) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 863792 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3nc(C)cs3)CC2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13-12-24-17(18-13)19-16(22)11-20-7-9-21(10-8-20)14-3-5-15(23-2)6-4-14/h3-6,12H,7-11H2,1-2H3,(H,18,19,22) |
| InChIKey | MXUDKLRFYNOHHW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|