C19H18N2O5S — CID 8641032
[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate (PubChem CID 8641032) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8641032 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
| SMILES | COc1ccc(-c2noc(COC(=O)/C=C/c3ccc(C)s3)n2)c(OC)c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-12-4-6-14(27-12)7-9-18(22)25-11-17-20-19(21-26-17)15-8-5-13(23-2)10-16(15)24-3/h4-10H,11H2,1-3H3/b9-7+ |
| InChIKey | BGJLTEAIBQUMAP-VQHVLOKHSA-N |
| XLogP | 3.88 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|