C24H22N2O3S — CID 8642439
[(2R)-1-[N-(2-cyanoethyl)anilino]-1-oxopropan-2-yl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 8642439) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(2R)-1-[N-(2-cyanoethyl)anilino]-1-oxopropan-2-yl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [(2R)-1-[N-(2-cyanoethyl)anilino]-1-oxopropan-2-yl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 8642439 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [(2R)-1-[N-(2-cyanoethyl)anilino]-1-oxopropan-2-yl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | C[C@@H](OC(=O)CSc1ccc2ccccc2c1)C(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O3S/c1-18(24(28)26(15-7-14-25)21-10-3-2-4-11-21)29-23(27)17-30-22-13-12-19-8-5-6-9-20(19)16-22/h2-6,8-13,16,18H,7,15,17H2,1H3/t18-/m1/s1 |
| InChIKey | DFDOPBICGABBIL-GOSISDBHSA-N |
| XLogP | 4.81 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |