C14H17N5O3S — CID 864297
N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide (PubChem CID 864297) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 864297 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2nnc(C)n2C)cc1 |
| InChI | InChI=1S/C14H17N5O3S/c1-9-15-18-14(19(9)2)23-8-12(20)16-17-13(21)10-4-6-11(22-3)7-5-10/h4-7H,8H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | YLTHTTDLKLECTK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|