C10H17N5OS — CID 864592
2-(2-morpholin-4-ylethylsulfanyl)pyrimidine-4,6-diamine (PubChem CID 864592) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylsulfanyl)pyrimidine-4,6-diamine.
| Compound Name | 2-(2-morpholin-4-ylethylsulfanyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 864592 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-(2-morpholin-4-ylethylsulfanyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCCN2CCOCC2)n1 |
| InChI | InChI=1S/C10H17N5OS/c11-8-7-9(12)14-10(13-8)17-6-3-15-1-4-16-5-2-15/h7H,1-6H2,(H4,11,12,13,14) |
| InChIKey | VRAUDKLOCCTHSW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |