C20H27N2O2+ — CID 8646102
[(1S)-1-(4-methoxyphenyl)propyl]-[(2R)-1-(3-methylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 8646102) has the molecular formula C20H27N2O2+ and a molecular weight of 327.45 g/mol. Its IUPAC name is [(1S)-1-(4-methoxyphenyl)propyl]-[(2R)-1-(3-methylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1S)-1-(4-methoxyphenyl)propyl]-[(2R)-1-(3-methylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8646102 |
| Molecular Formula | C20H27N2O2+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | [(1S)-1-(4-methoxyphenyl)propyl]-[(2R)-1-(3-methylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | CC[C@H]([NH2+][C@H](C)C(=O)Nc1cccc(C)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-5-19(16-9-11-18(24-4)12-10-16)21-15(3)20(23)22-17-8-6-7-14(2)13-17/h6-13,15,19,21H,5H2,1-4H3,(H,22,23)/p+1/t15-,19+/m1/s1 |
| InChIKey | DDYSTWULWCUTMQ-BEFAXECRSA-O |
| XLogP | 3.05 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |