C20H22N2O6 — CID 8647935
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-2-(3-methyl-4-nitrophenoxy)acetamide (PubChem CID 8647935) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-2-(3-methyl-4-nitrophenoxy)acetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-2-(3-methyl-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 8647935 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-2-(3-methyl-4-nitrophenoxy)acetamide |
| SMILES | CCN(Cc1ccc2c(c1)OCCO2)C(=O)COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-3-21(12-15-4-7-18-19(11-15)27-9-8-26-18)20(23)13-28-16-5-6-17(22(24)25)14(2)10-16/h4-7,10-11H,3,8-9,12-13H2,1-2H3 |
| InChIKey | SYLHGSVNJMPFIO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|