C14H19N3O5 — CID 8648040
2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]-N-propylacetamide (PubChem CID 8648040) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]-N-propylacetamide.
| Compound Name | 2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 8648040 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(=O)COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H19N3O5/c1-3-6-15-13(18)8-16-14(19)9-22-11-4-5-12(17(20)21)10(2)7-11/h4-5,7H,3,6,8-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | CZBCCYQZCMEORF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|