C16H14N2O6 — CID 8648318
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 8648318) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8648318 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)OCC(=O)N2CCOC2=O)cc1 |
| InChI | InChI=1S/C16H14N2O6/c1-22-13-4-2-11(3-5-13)8-12(9-17)15(20)24-10-14(19)18-6-7-23-16(18)21/h2-5,8H,6-7,10H2,1H3/b12-8+ |
| InChIKey | YGOYRMCLLIGKPB-XYOKQWHBSA-N |
| XLogP | 1.12 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|