About 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile
2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile (PubChem CID 864977) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile |
| PubChem CID | 864977 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile |
| SMILES | Cc1cc2cc(C=C(C#N)C#N)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C15H11N3O/c1-9-3-12-6-13(5-11(7-16)8-17)15(19)18-14(12)4-10(9)2/h3-6H,1-2H3,(H,18,19) |
| InChIKey | TWKVLWXMOQNJMC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile?
The IUPAC name of 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile (CID 864977) is 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile.
What is the SMILES notation for 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile?
The canonical SMILES for 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile is Cc1cc2cc(C=C(C#N)C#N)c(=O)[nH]c2cc1C.
What is the InChIKey of 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile?
The InChIKey is TWKVLWXMOQNJMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c1-9-3-12-6-13(5-11(7-16)8-17)15(19)18-14(12)4-10(9)2/h3-6H,1-2H3,(H,18,19).
What are the key properties of 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile?
2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile has a molecular weight of 249.27 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylidene]propanedinitrile is sourced from PubChem (CID 864977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).