C21H22N2O2S — CID 8650150
methyl (6R)-4-methyl-3,6-bis(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8650150) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is methyl (6R)-4-methyl-3,6-bis(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6R)-4-methyl-3,6-bis(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8650150 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl (6R)-4-methyl-3,6-bis(3-methylphenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(C)c2)C(=S)N[C@@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-13-7-5-9-16(11-13)19-18(20(24)25-4)15(3)23(21(26)22-19)17-10-6-8-14(2)12-17/h5-12,19H,1-4H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | QGFCGZPKSOFOKP-LJQANCHMSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|