C14H14Cl2FNO5S — CID 8650584
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8650584) has the molecular formula C14H14Cl2FNO5S and a molecular weight of 398.24 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8650584 |
| Molecular Formula | C14H14Cl2FNO5S |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CN(C(=O)COC(=O)c1cc(F)c(Cl)cc1Cl)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14Cl2FNO5S/c1-18(8-2-3-24(21,22)7-8)13(19)6-23-14(20)9-4-12(17)11(16)5-10(9)15/h4-5,8H,2-3,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | WMEFUNAACNDCIW-QMMMGPOBSA-N |
| XLogP | 1.93 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|