C17H15N3O6 — CID 8651961
ethyl 6-methyl-3-[(2-nitrophenyl)methyl]-4-oxofuro[2,3-d]pyrimidine-5-carboxylate (PubChem CID 8651961) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is ethyl 6-methyl-3-[(2-nitrophenyl)methyl]-4-oxofuro[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-3-[(2-nitrophenyl)methyl]-4-oxofuro[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8651961 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl 6-methyl-3-[(2-nitrophenyl)methyl]-4-oxofuro[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ncn(Cc3ccccc3[N+](=O)[O-])c(=O)c12 |
| InChI | InChI=1S/C17H15N3O6/c1-3-25-17(22)13-10(2)26-15-14(13)16(21)19(9-18-15)8-11-6-4-5-7-12(11)20(23)24/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | OQNUVDHDPPQSTQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 117.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|