C20H21N3OS — CID 8652008
(4S)-N,N,6-trimethyl-4-(4-phenylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 8652008) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is (4S)-N,N,6-trimethyl-4-(4-phenylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4S)-N,N,6-trimethyl-4-(4-phenylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 8652008 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (4S)-N,N,6-trimethyl-4-(4-phenylphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C)[C@H](c2ccc(-c3ccccc3)cc2)NC(=S)N1 |
| InChI | InChI=1S/C20H21N3OS/c1-13-17(19(24)23(2)3)18(22-20(25)21-13)16-11-9-15(10-12-16)14-7-5-4-6-8-14/h4-12,18H,1-3H3,(H2,21,22,25)/t18-/m0/s1 |
| InChIKey | NROLASDJVYIMGR-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|