C19H17N3 — CID 865238
1,4,8-trimethylquinolino[2,3-b]quinolin-12-amine (PubChem CID 865238) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is 1,4,8-trimethylquinolino[2,3-b]quinolin-12-amine.
| Compound Name | 1,4,8-trimethylquinolino[2,3-b]quinolin-12-amine |
|---|---|
| PubChem CID | 865238 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1,4,8-trimethylquinolino[2,3-b]quinolin-12-amine |
| SMILES | Cc1ccc2cc3c(N)c4c(C)ccc(C)c4nc3nc2c1 |
| InChI | InChI=1S/C19H17N3/c1-10-4-7-13-9-14-17(20)16-11(2)5-6-12(3)18(16)22-19(14)21-15(13)8-10/h4-9H,1-3H3,(H2,20,21,22) |
| InChIKey | MLCOGORERKDZTI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|