About 2,7-dimethylquinolino[2,3-b]quinolin-11-amine
2,7-dimethylquinolino[2,3-b]quinolin-11-amine (PubChem CID 865239) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 2,7-dimethylquinolino[2,3-b]quinolin-11-amine.
Molecular Properties
| Compound Name | 2,7-dimethylquinolino[2,3-b]quinolin-11-amine |
| PubChem CID | 865239 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2,7-dimethylquinolino[2,3-b]quinolin-11-amine |
| SMILES | Cc1ccc2nc3nc4c(C)cccc4c(N)c3cc2c1 |
| InChI | InChI=1S/C18H15N3/c1-10-6-7-15-12(8-10)9-14-16(19)13-5-3-4-11(2)17(13)21-18(14)20-15/h3-9H,1-2H3,(H2,19,20,21) |
| InChIKey | GZONZEUVQKWERU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethylquinolino[2,3-b]quinolin-11-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylquinolino[2,3-b]quinolin-11-amine?
The IUPAC name of 2,7-dimethylquinolino[2,3-b]quinolin-11-amine (CID 865239) is 2,7-dimethylquinolino[2,3-b]quinolin-11-amine.
What is the SMILES notation for 2,7-dimethylquinolino[2,3-b]quinolin-11-amine?
The canonical SMILES for 2,7-dimethylquinolino[2,3-b]quinolin-11-amine is Cc1ccc2nc3nc4c(C)cccc4c(N)c3cc2c1.
What is the InChIKey of 2,7-dimethylquinolino[2,3-b]quinolin-11-amine?
The InChIKey is GZONZEUVQKWERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c1-10-6-7-15-12(8-10)9-14-16(19)13-5-3-4-11(2)17(13)21-18(14)20-15/h3-9H,1-2H3,(H2,19,20,21).
What are the key properties of 2,7-dimethylquinolino[2,3-b]quinolin-11-amine?
2,7-dimethylquinolino[2,3-b]quinolin-11-amine has a molecular weight of 273.34 g/mol, XLogP of 4.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylquinolino[2,3-b]quinolin-11-amine is sourced from PubChem (CID 865239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).